cas: 220607-75-0 — see every product listed under this CAS number, including other names
2-Bromo-1-(3,5-difluorophenyl)ethanone, 97% (CAS 220607-75-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211557-1G |
| cas | 220607-75-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 653.95 Pln | |
| Fluorochem | 10g | 1002.79 Pln | |
| Fluorochem | 25g | 1872.28 Pln | |
| Fluorochem | 100g | 6136.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-1-(3,5-difluorophenyl)ethanone (CAS 220607-75-0) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 2-bromo-1-(3,5-difluorophenyl)ethanone. InChIKey: CJEGSZFRYLCTLK-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 2-bromo-1-(3,5-difluorophenyl)ethanone |
| InChIKey | CJEGSZFRYLCTLK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(=O)CBr |
Computed by PubChem (NCBI)