CAS 435273-49-7 is the registry number for 2-Bromo-1-(3-bromo-4-fluorophenyl)ethanone, 97%. Offered by: Fluorochem. Available pack sizes: 5g, 10g, 25g.
2-bromo-1-(3-bromo-4-fluorophenyl)ethanone (CAS 435273-49-7) is a chemical compound with the molecular formula C8H5Br2FO and a molecular weight of 295.93 g/mol. IUPAC name: 2-bromo-1-(3-bromo-4-fluorophenyl)ethanone. InChIKey: NVCNENXQUDVWRV-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2FO |
|---|---|
| Molecular weight | 295.93 g/mol |
| IUPAC name | 2-bromo-1-(3-bromo-4-fluorophenyl)ethanone |
| InChIKey | NVCNENXQUDVWRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CBr)Br)F |
Computed by PubChem (NCBI)