CAS 1427446-94-3 is the registry number for 2-Bromo-1-(2-bromo-5-fluorophenyl)ethan-1-one, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-bromo-1-(2-bromo-5-fluorophenyl)ethanone (CAS 1427446-94-3) is a chemical compound with the molecular formula C8H5Br2FO and a molecular weight of 295.93 g/mol. IUPAC name: 2-bromo-1-(2-bromo-5-fluorophenyl)ethanone. InChIKey: NYXFGTZHLKBZIL-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2FO |
|---|---|
| Molecular weight | 295.93 g/mol |
| IUPAC name | 2-bromo-1-(2-bromo-5-fluorophenyl)ethanone |
| InChIKey | NYXFGTZHLKBZIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)CBr)Br |
Computed by PubChem (NCBI)