CAS 7542-64-5 appears in our catalog under these names: Alpha,alpha-dibromo-4-fluoroacetophenone, 95%, 2,2-Dibromo-4'-fluoroacetophenone, 98% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g.
2,2-dibromo-1-(4-fluorophenyl)ethanone (CAS 7542-64-5) is a chemical compound with the molecular formula C8H5Br2FO and a molecular weight of 295.93 g/mol. IUPAC name: 2,2-dibromo-1-(4-fluorophenyl)ethanone. InChIKey: XFFGHBAVJPOWDG-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2FO |
|---|---|
| Molecular weight | 295.93 g/mol |
| IUPAC name | 2,2-dibromo-1-(4-fluorophenyl)ethanone |
| InChIKey | XFFGHBAVJPOWDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(Br)Br)F |
Computed by PubChem (NCBI)