CAS 1224739-02-9 appears in our catalog under these names: 2,2-Dibromo-1-(2-fluorophenyl)ethan-1-one, 98%, Vonoprazan Impurity 93, Vonoprazan Impurity 62. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dibromo-1-(2-fluorophenyl)ethanone (CAS 1224739-02-9) is a chemical compound with the molecular formula C8H5Br2FO and a molecular weight of 295.93 g/mol. IUPAC name: 2,2-dibromo-1-(2-fluorophenyl)ethanone. InChIKey: XNDJICZCBSSYHX-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2FO |
|---|---|
| Molecular weight | 295.93 g/mol |
| IUPAC name | 2,2-dibromo-1-(2-fluorophenyl)ethanone |
| InChIKey | XNDJICZCBSSYHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(Br)Br)F |
Computed by PubChem (NCBI)