CAS 1204333-47-0 appears in our catalog under these names: 2–Bromo–1–(3–bromo–2–fluorophenyl)ethanone, 2-Bromo-1-(3-bromo-2-fluorophenyl)ethanone 95%, 3-Bromo-2-fluorophenacyl bromide, 95%, 95%, 2-Bromo-1-(3-bromo-2-fluorophenyl)ethanone, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-1-(3-bromo-2-fluorophenyl)ethanone (CAS 1204333-47-0) is a chemical compound with the molecular formula C8H5Br2FO and a molecular weight of 295.93 g/mol. IUPAC name: 2-bromo-1-(3-bromo-2-fluorophenyl)ethanone. InChIKey: KIEKKGYJVKMVTG-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2FO |
|---|---|
| Molecular weight | 295.93 g/mol |
| IUPAC name | 2-bromo-1-(3-bromo-2-fluorophenyl)ethanone |
| InChIKey | KIEKKGYJVKMVTG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)C(=O)CBr |
Computed by PubChem (NCBI)