CAS 296281-77-1 is the registry number for 2,2-Dibromo-1-(3-fluorophenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dibromo-1-(3-fluorophenyl)ethanone (CAS 296281-77-1) is a chemical compound with the molecular formula C8H5Br2FO and a molecular weight of 295.93 g/mol. IUPAC name: 2,2-dibromo-1-(3-fluorophenyl)ethanone. InChIKey: NZHQKSNIAYKLQJ-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2FO |
|---|---|
| Molecular weight | 295.93 g/mol |
| IUPAC name | 2,2-dibromo-1-(3-fluorophenyl)ethanone |
| InChIKey | NZHQKSNIAYKLQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)C(Br)Br |
Computed by PubChem (NCBI)