Products 1427452-18-3
CAS 1427452-18-3 is the registry number for 2-Bromo-3-fluorophenacyl bromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-(2-bromo-3-fluorophenyl)ethanone (CAS 1427452-18-3) is a chemical compound with the molecular formula C8H5Br2FO and a molecular weight of 295.93 g/mol. IUPAC name: 2-bromo-1-(2-bromo-3-fluorophenyl)ethanone. InChIKey: MXYYCYJHDAXBTP-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2FO |
|---|---|
| Molecular weight | 295.93 g/mol |
| IUPAC name | 2-bromo-1-(2-bromo-3-fluorophenyl)ethanone |
| InChIKey | MXYYCYJHDAXBTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Br)C(=O)CBr |
Computed by PubChem (NCBI)
Synonyms:
2-Bromo-3-fluorophenacyl bromide