2-Bromo-1-(4-bromo-3-chlorophenyl)ethanone, 97%
cas: 87427-57-4 — see every product listed under this CAS number, including other names
2-Bromo-1-(4-bromo-3-chlorophenyl)ethanone, 97% (CAS 87427-57-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A112307-250mg |
| cas | 87427-57-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 1265.94 Pln | |
| Ambeed | 5g | 3691.19 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1437.20 Pln | |
| BLDpharm | 100mg | 314.36 Pln | |
| BLDpharm | 250mg | 580.93 Pln | |
| BLDpharm | 1g | 1358.44 Pln | |
| BLDpharm | 5g | 3974.18 Pln | |
| Fluorochem | 100mg | 612.30 Pln | |
| Fluorochem | 250mg | 1122.54 Pln | |
| Fluorochem | 1g | 2674.08 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-bromo-1-(4-bromo-3-chlorophenyl)ethanone (CAS 87427-57-4) is a chemical compound with the molecular formula C8H5Br2ClO and a molecular weight of 312.38 g/mol. IUPAC name: 2-bromo-1-(4-bromo-3-chlorophenyl)ethanone. InChIKey: IBQWUOVRWLPTKR-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2ClO |
|---|---|
| Molecular weight | 312.38 g/mol |
| IUPAC name | 2-bromo-1-(4-bromo-3-chlorophenyl)ethanone |
| InChIKey | IBQWUOVRWLPTKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CBr)Cl)Br |
Computed by PubChem (NCBI)