Products 87427-58-5
CAS 87427-58-5 appears in our catalog under these names: 2-Bromo-1-(3-bromo-4-chlorophenyl)ethanone 97%, 2-Bromo-1-(3-bromo-4-chlorophenyl)ethanone, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-1-(3-bromo-4-chlorophenyl)ethanone (CAS 87427-58-5) is a chemical compound with the molecular formula C8H5Br2ClO and a molecular weight of 312.38 g/mol. IUPAC name: 2-bromo-1-(3-bromo-4-chlorophenyl)ethanone. InChIKey: VWCVEOFSDAFTHO-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2ClO |
|---|---|
| Molecular weight | 312.38 g/mol |
| IUPAC name | 2-bromo-1-(3-bromo-4-chlorophenyl)ethanone |
| InChIKey | VWCVEOFSDAFTHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CBr)Br)Cl |
Computed by PubChem (NCBI)