CAS 1261522-20-6 is the registry number for 3-Bromo-5-chlorophenacyl bromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-(3-bromo-5-chlorophenyl)ethanone (CAS 1261522-20-6) is a chemical compound with the molecular formula C8H5Br2ClO and a molecular weight of 312.38 g/mol. IUPAC name: 2-bromo-1-(3-bromo-5-chlorophenyl)ethanone. InChIKey: JZDHBNBZUDANLV-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2ClO |
|---|---|
| Molecular weight | 312.38 g/mol |
| IUPAC name | 2-bromo-1-(3-bromo-5-chlorophenyl)ethanone |
| InChIKey | JZDHBNBZUDANLV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Br)C(=O)CBr |
Computed by PubChem (NCBI)