CAS 13651-12-2 appears in our catalog under these names: 2,2-Dibromo-1-(4-chlorophenyl)ethanone, 95%, 2,2-Dibromo-1-(4-chlorophenyl)ethanone, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2,2-dibromo-1-(4-chlorophenyl)ethanone (CAS 13651-12-2) is a chemical compound with the molecular formula C8H5Br2ClO and a molecular weight of 312.38 g/mol. IUPAC name: 2,2-dibromo-1-(4-chlorophenyl)ethanone. InChIKey: UBWBLFIQIJHEDN-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2ClO |
|---|---|
| Molecular weight | 312.38 g/mol |
| IUPAC name | 2,2-dibromo-1-(4-chlorophenyl)ethanone |
| InChIKey | UBWBLFIQIJHEDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(Br)Br)Cl |
Computed by PubChem (NCBI)