Products 25847-29-4
CAS 25847-29-4 appears in our catalog under these names: 2,2-Dibromo-1-(3-chlorophenyl)ethanone, 95%, 95%, Antifungal agent 139. Offered by: Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, Get quote.
2,2-dibromo-1-(3-chlorophenyl)ethanone (CAS 25847-29-4) is a chemical compound with the molecular formula C8H5Br2ClO and a molecular weight of 312.38 g/mol. IUPAC name: 2,2-dibromo-1-(3-chlorophenyl)ethanone. InChIKey: KMIVMVCQQHYHEK-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2ClO |
|---|---|
| Molecular weight | 312.38 g/mol |
| IUPAC name | 2,2-dibromo-1-(3-chlorophenyl)ethanone |
| InChIKey | KMIVMVCQQHYHEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)C(Br)Br |
Computed by PubChem (NCBI)