CAS 34356-83-7 appears in our catalog under these names: Tulobuterol Impurity 3, 2,2-Dibromo-1-(2-chlorophenyl)ethanone, ≥95%, ≥95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 10g.
2,2-dibromo-1-(2-chlorophenyl)ethanone (CAS 34356-83-7) is a chemical compound with the molecular formula C8H5Br2ClO and a molecular weight of 312.38 g/mol. IUPAC name: 2,2-dibromo-1-(2-chlorophenyl)ethanone. InChIKey: ZIJBOKNENCASCS-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2ClO |
|---|---|
| Molecular weight | 312.38 g/mol |
| IUPAC name | 2,2-dibromo-1-(2-chlorophenyl)ethanone |
| InChIKey | ZIJBOKNENCASCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(Br)Br)Cl |
Computed by PubChem (NCBI)