CAS 1261775-99-8 appears in our catalog under these names: 2'-Chloro-2,5'-dibromoacetophenone, 95%, 5-Bromo-2-chlorophenacyl bromide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-bromo-1-(5-bromo-2-chlorophenyl)ethanone (CAS 1261775-99-8) is a chemical compound with the molecular formula C8H5Br2ClO and a molecular weight of 312.38 g/mol. IUPAC name: 2-bromo-1-(5-bromo-2-chlorophenyl)ethanone. InChIKey: CPYOJYNOGRYUIQ-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2ClO |
|---|---|
| Molecular weight | 312.38 g/mol |
| IUPAC name | 2-bromo-1-(5-bromo-2-chlorophenyl)ethanone |
| InChIKey | CPYOJYNOGRYUIQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)CBr)Cl |
Computed by PubChem (NCBI)