cas: 68322-84-9 — see every product listed under this CAS number, including other names
2-Bromo-1-fluoro-4-(trifluoromethyl)benzene 98% (CAS 68322-84-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100698-5g |
| cas | 68322-84-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 264.69 Pln | |
| Ambeed | 500g | 659.62 Pln | |
| Ambeed | 1000g | 1249.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A100698 |
2-bromo-1-fluoro-4-(trifluoromethyl)benzene (CAS 68322-84-9) is a chemical compound with the molecular formula C7H3BrF4 and a molecular weight of 243.00 g/mol. IUPAC name: 2-bromo-1-fluoro-4-(trifluoromethyl)benzene. InChIKey: RZJOIMPUMMQKFR-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4 |
|---|---|
| Molecular weight | 243.00 g/mol |
| IUPAC name | 2-bromo-1-fluoro-4-(trifluoromethyl)benzene |
| InChIKey | RZJOIMPUMMQKFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)F |
Computed by PubChem (NCBI)