cas: 68322-84-9 — see every product listed under this CAS number, including other names
2-Bromo-1-fluoro-4-(trifluoromethyl)benzene, 98%, 98% (CAS 68322-84-9) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114J2P-1kg |
| cas | 68322-84-9 |
| size | 1kg |
| availability | 12000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 870.80 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 141.20 Pln | |
| Chemat | 500g | 518.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1-fluoro-4-(trifluoromethyl)benzene (CAS 68322-84-9) is a chemical compound with the molecular formula C7H3BrF4 and a molecular weight of 243.00 g/mol. IUPAC name: 2-bromo-1-fluoro-4-(trifluoromethyl)benzene. InChIKey: RZJOIMPUMMQKFR-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4 |
|---|---|
| Molecular weight | 243.00 g/mol |
| IUPAC name | 2-bromo-1-fluoro-4-(trifluoromethyl)benzene |
| InChIKey | RZJOIMPUMMQKFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)F |
Computed by PubChem (NCBI)