cas: 68322-84-9 — see every product listed under this CAS number, including other names
3-Bromo-4-fluorobenzotrifluoride, 97% (CAS 68322-84-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F004215-1G |
| cas | 68322-84-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 206.20 Pln | |
| Fluorochem | 500g | 633.13 Pln | |
| Fluorochem | 1kg | 1205.84 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97% |
2-bromo-1-fluoro-4-(trifluoromethyl)benzene (CAS 68322-84-9) is a chemical compound with the molecular formula C7H3BrF4 and a molecular weight of 243.00 g/mol. IUPAC name: 2-bromo-1-fluoro-4-(trifluoromethyl)benzene. InChIKey: RZJOIMPUMMQKFR-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4 |
|---|---|
| Molecular weight | 243.00 g/mol |
| IUPAC name | 2-bromo-1-fluoro-4-(trifluoromethyl)benzene |
| InChIKey | RZJOIMPUMMQKFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)F |
Computed by PubChem (NCBI)