cas: 1056264-66-4 — see every product listed under this CAS number, including other names
2-Bromo-3-chloro-6-fluorobenzaldehyde 95% (CAS 1056264-66-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A437403-100mg |
| cas | 1056264-66-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 520.56 Pln | |
| Ambeed | 25g | 1677.56 Pln | |
| Ambeed | 100g | 6422.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A437403 |
2-bromo-3-chloro-6-fluorobenzaldehyde (CAS 1056264-66-4) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 2-bromo-3-chloro-6-fluorobenzaldehyde. InChIKey: XDWZRCXBBQWCBS-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 2-bromo-3-chloro-6-fluorobenzaldehyde |
| InChIKey | XDWZRCXBBQWCBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C=O)Br)Cl |
Computed by PubChem (NCBI)