cas: 35757-20-1 — see every product listed under this CAS number, including other names
2-Bromo-3-nitroaniline 95% (CAS 35757-20-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A169418-100mg |
| cas | 35757-20-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1377.19 Pln | |
| Ambeed | 5g | 4436.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A169418 |
2-bromo-3-nitroaniline (CAS 35757-20-1) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 2-bromo-3-nitroaniline. InChIKey: GDKBUWQOCGJBFX-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 2-bromo-3-nitroaniline |
| InChIKey | GDKBUWQOCGJBFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Br)N |
Computed by PubChem (NCBI)