cas: 32864-29-2 — see every product listed under this CAS number, including other names
2-Bromo-3-phenylpyridine 95% (CAS 32864-29-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A102470-100mg |
| cas | 32864-29-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1327.12 Pln | |
| Ambeed | 5g | 4469.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A102470 |
2-bromo-3-phenylpyridine (CAS 32864-29-2) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 2-bromo-3-phenylpyridine. InChIKey: BCKWPWFSMVGPRC-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 2-bromo-3-phenylpyridine |
| InChIKey | BCKWPWFSMVGPRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=CC=C2)Br |
Computed by PubChem (NCBI)