cas: 32864-29-2 — see every product listed under this CAS number, including other names
2-Bromo-3-phenylpyridine, 98%, 98% (CAS 32864-29-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C18C-50mg |
| cas | 32864-29-2 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 251.60 Pln | |
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1427.60 Pln | |
| Chemat | 5g | 5344.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromo-3-phenylpyridine (CAS 32864-29-2) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 2-bromo-3-phenylpyridine. InChIKey: BCKWPWFSMVGPRC-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 2-bromo-3-phenylpyridine |
| InChIKey | BCKWPWFSMVGPRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=CC=C2)Br |
Computed by PubChem (NCBI)