cas: 351003-42-4 — see every product listed under this CAS number, including other names
2-Bromo-4,6-difluorobenzene-1-sulfonyl chloride, 98% (CAS 351003-42-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A243775-1g |
| cas | 351003-42-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 564.76 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-bromo-4,6-difluorobenzenesulfonyl chloride (CAS 351003-42-4) is a chemical compound with the molecular formula C6H2BrClF2O2S and a molecular weight of 291.50 g/mol. IUPAC name: 2-bromo-4,6-difluorobenzenesulfonyl chloride. InChIKey: LBDIILUAEZRJMW-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF2O2S |
|---|---|
| Molecular weight | 291.50 g/mol |
| IUPAC name | 2-bromo-4,6-difluorobenzenesulfonyl chloride |
| InChIKey | LBDIILUAEZRJMW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)S(=O)(=O)Cl)Br)F |
Computed by PubChem (NCBI)