Products 1805119-83-8

CAS 1805119-83-8 is the registry number for 5-Bromo-2,3-difluorobenzenesulfonyl chloride, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

5-bromo-2,3-difluorobenzenesulfonyl chloride (CAS 1805119-83-8) is a chemical compound with the molecular formula C6H2BrClF2O2S and a molecular weight of 291.50 g/mol. IUPAC name: 5-bromo-2,3-difluorobenzenesulfonyl chloride. InChIKey: OOFZACGRMCSIQW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2BrClF2O2S
Molecular weight291.50 g/mol
IUPAC name5-bromo-2,3-difluorobenzenesulfonyl chloride
InChIKeyOOFZACGRMCSIQW-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)F)S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)