Products 1349708-71-9

CAS 1349708-71-9 is the registry number for 3-Bromo-2,6-difluorobenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-bromo-2,6-difluorobenzenesulfonyl chloride (CAS 1349708-71-9) is a chemical compound with the molecular formula C6H2BrClF2O2S and a molecular weight of 291.50 g/mol. IUPAC name: 3-bromo-2,6-difluorobenzenesulfonyl chloride. InChIKey: IYITVCPKVNTTNA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2BrClF2O2S
Molecular weight291.50 g/mol
IUPAC name3-bromo-2,6-difluorobenzenesulfonyl chloride
InChIKeyIYITVCPKVNTTNA-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1F)S(=O)(=O)Cl)F)Br

Computed by PubChem (NCBI)