Products 874804-10-1
CAS 874804-10-1 appears in our catalog under these names: 3-Bromo-2,4-difluorobenzene-1-sulfonyl chloride, 3-Bromo-2,4-difluorobenzenesulfonyl chloride. Offered by: Biosynth, Fluorochem. Available pack sizes: 50mg, 0,5g, 1g, 5g.
3-bromo-2,4-difluorobenzenesulfonyl chloride (CAS 874804-10-1) is a chemical compound with the molecular formula C6H2BrClF2O2S and a molecular weight of 291.50 g/mol. IUPAC name: 3-bromo-2,4-difluorobenzenesulfonyl chloride. InChIKey: PXIPSUBAGXNJEP-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF2O2S |
|---|---|
| Molecular weight | 291.50 g/mol |
| IUPAC name | 3-bromo-2,4-difluorobenzenesulfonyl chloride |
| InChIKey | PXIPSUBAGXNJEP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)Br)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)