cas: 1114808-87-5 — see every product listed under this CAS number, including other names
2-Bromo-4-(trifluoromethoxy)benzaldehyde, 97% (CAS 1114808-87-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F321293-250MG |
| cas | 1114808-87-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 471.73 Pln | |
| Fluorochem | 5g | 1294.35 Pln | |
| Fluorochem | 10g | 2528.29 Pln | |
| Fluorochem | 25g | 3731.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-4-(trifluoromethoxy)benzaldehyde (CAS 1114808-87-5) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 2-bromo-4-(trifluoromethoxy)benzaldehyde. InChIKey: NTFBYDIXDWHKBX-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethoxy)benzaldehyde |
| InChIKey | NTFBYDIXDWHKBX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Br)C=O |
Computed by PubChem (NCBI)