Products 1227605-02-8
CAS 1227605-02-8 appears in our catalog under these names: 3-bromo-2-(trifluoromethyl)benzoic acid, 95%, 3-Bromo-2-(trifluoromethyl)benzoic acid, 98%, 3–Bromo–2–(trifluoromethyl)benzoic acid, 3-Bromo-2-(trifluoromethyl)benzoic acid, 97%, 97%, 3-Bromo-2-(trifluoromethyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
3-bromo-2-(trifluoromethyl)benzoic acid (CAS 1227605-02-8) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 3-bromo-2-(trifluoromethyl)benzoic acid. InChIKey: PZGTYJFUVHSNLB-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 3-bromo-2-(trifluoromethyl)benzoic acid |
| InChIKey | PZGTYJFUVHSNLB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)