cas: 74317-85-4 — see every product listed under this CAS number, including other names
2-Bromo-4-methoxybenzoic acid 98% (CAS 74317-85-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A141030-1g |
| cas | 74317-85-4 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 353.69 Pln | |
| Ambeed | 100g | 698.56 Pln | |
| Ambeed | 500g | 3207.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A141030 |
2-bromo-4-methoxybenzoic acid (CAS 74317-85-4) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-bromo-4-methoxybenzoic acid. InChIKey: SEJVMKLJNIKFAF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-bromo-4-methoxybenzoic acid |
| InChIKey | SEJVMKLJNIKFAF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)O)Br |
Computed by PubChem (NCBI)