CAS 74317-85-4 appears in our catalog under these names: 2–Bromo–4–methoxybenzoic acid, 2-Bromo-4-methoxybenzoic acid 98%, 2-Bromo-4-methoxybenzoic acid, 97%, 2-Bromo-4-methoxybenzoic acid, >95% (HPLC). Offered by: GLPBio, Ambeed, Fluorochem, TRC. Available pack sizes: 10g, 100g, 25g, 1g, 5g, 500g, 100mg, 250mg.
2-bromo-4-methoxybenzoic acid (CAS 74317-85-4) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-bromo-4-methoxybenzoic acid. InChIKey: SEJVMKLJNIKFAF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-bromo-4-methoxybenzoic acid |
| InChIKey | SEJVMKLJNIKFAF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)O)Br |
Computed by PubChem (NCBI)