cas: 5847-59-6 — see every product listed under this CAS number, including other names
2-Bromo-4-nitrophenol, >98.0%(GC)(T) (CAS 5847-59-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B3918-1G |
| cas | 5847-59-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 267.35 Pln | |
| TCI | 5g | 714.82 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2-bromo-4-nitrophenol (CAS 5847-59-6) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 2-bromo-4-nitrophenol. InChIKey: DCIPFSYBGTWYCR-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 2-bromo-4-nitrophenol |
| InChIKey | DCIPFSYBGTWYCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Br)O |
Computed by PubChem (NCBI)