cas: 5847-59-6 — see every product listed under this CAS number, including other names
2-Bromo-4-nitrophenol, 95% (CAS 5847-59-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077292-1G |
| cas | 5847-59-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 539.41 Pln | |
| Fluorochem | 500g | 1841.04 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-bromo-4-nitrophenol (CAS 5847-59-6) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 2-bromo-4-nitrophenol. InChIKey: DCIPFSYBGTWYCR-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 2-bromo-4-nitrophenol |
| InChIKey | DCIPFSYBGTWYCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Br)O |
Computed by PubChem (NCBI)