cas: 54151-74-5 — see every product listed under this CAS number, including other names
2-Bromo-4-phenylpyridine, 98%, 98% (CAS 54151-74-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 25g, 250mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DE2Z-100mg |
| cas | 54151-74-5 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 333.20 Pln | |
| Chemat | 25g | 1034.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 10g | 568.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromo-4-phenylpyridine (CAS 54151-74-5) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 2-bromo-4-phenylpyridine. InChIKey: KRIILKQTJUOQCJ-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 2-bromo-4-phenylpyridine |
| InChIKey | KRIILKQTJUOQCJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC=C2)Br |
Computed by PubChem (NCBI)