cas: 54151-74-5 — see every product listed under this CAS number, including other names
2-Bromo-4-phenylpyridine, 98% (CAS 54151-74-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233124-250MG |
| cas | 54151-74-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 346.77 Pln | |
| Fluorochem | 10g | 627.92 Pln | |
| Fluorochem | 25g | 1174.60 Pln | |
| Fluorochem | 100g | 4506.76 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-4-phenylpyridine (CAS 54151-74-5) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 2-bromo-4-phenylpyridine. InChIKey: KRIILKQTJUOQCJ-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 2-bromo-4-phenylpyridine |
| InChIKey | KRIILKQTJUOQCJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC=C2)Br |
Computed by PubChem (NCBI)