cas: 739336-26-6 — see every product listed under this CAS number, including other names
2-Bromo-5-fluorophenylacetic acid, 97% (CAS 739336-26-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092814-1G |
| cas | 739336-26-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 351.98 Pln | |
| Fluorochem | 100g | 1226.67 Pln | |
| Fluorochem | 500g | 3819.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-(2-bromo-5-fluorophenyl)acetic acid (CAS 739336-26-6) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-(2-bromo-5-fluorophenyl)acetic acid. InChIKey: BPNWLZNAKZSBHH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-(2-bromo-5-fluorophenyl)acetic acid |
| InChIKey | BPNWLZNAKZSBHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CC(=O)O)Br |
Computed by PubChem (NCBI)