cas: 22921-68-2 — see every product listed under this CAS number, including other names
2-Bromo-5-methoxybenzoic acid, 98%, 98% (CAS 22921-68-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113LIG-5g |
| cas | 22921-68-2 |
| size | 5g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 88.40 Pln | |
| Chemat | 100g | 117.20 Pln | |
| Chemat | 250g | 184.40 Pln | |
| Chemat | 500g | 369.60 Pln | |
| Chemat | 1kg | 635.60 Pln | |
| Chemat | 5kg | 3278.40 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromo-5-methoxybenzoic acid (CAS 22921-68-2) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-bromo-5-methoxybenzoic acid. InChIKey: ODHJOROUCITYNF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-bromo-5-methoxybenzoic acid |
| InChIKey | ODHJOROUCITYNF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)