cas: 22921-68-2 — see every product listed under this CAS number, including other names
2-Bromo-5-methoxybenzoic acid, 98% (CAS 22921-68-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 500g, 100g, 1kg, 25g, 10g, 1g. Offered by: Combi-blocks, Sigma-Aldrich, Fluorochem, Ambeed.
| brand | Combi-blocks |
|---|---|
| catalog number | CA-4278-5g |
| cas | 22921-68-2 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 500g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 1kg | price on request | |
| Combi-blocks | 25g | price on request | |
| Sigma-Aldrich | 5G | 126.00 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 185.37 Pln | |
| Fluorochem | 500g | 539.41 Pln | |
| Fluorochem | 1kg | 950.72 Pln | |
| Ambeed | 1kg | 1388.31 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 253.56 Pln | |
| Ambeed | 500g | 731.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-bromo-5-methoxybenzoic acid (CAS 22921-68-2) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-bromo-5-methoxybenzoic acid. InChIKey: ODHJOROUCITYNF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-bromo-5-methoxybenzoic acid |
| InChIKey | ODHJOROUCITYNF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)