cas: 943-14-6 — see every product listed under this CAS number, including other names
2-Bromo-5-nitrobenzoic acid 98% (CAS 943-14-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A490036-5g |
| cas | 943-14-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 25g | 342.56 Pln | |
| Ambeed | 100g | 1021.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A490036 |
2-bromo-5-nitrobenzoic acid (CAS 943-14-6) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 2-bromo-5-nitrobenzoic acid. InChIKey: UVFWYVCDRKRAJH-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 2-bromo-5-nitrobenzoic acid |
| InChIKey | UVFWYVCDRKRAJH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)Br |
Computed by PubChem (NCBI)