CAS 101420-81-9 appears in our catalog under these names: 3–Bromo–4–nitrobenzoic Acid, 3-Bromo-4-nitrobenzoic acid, 97% , 3-Bromo-4-nitrobenzoic Acid, >98.0%(GC)(T), 3-Bromo-4-nitrobenzoic acid, 3-Bromo-4-nitrobenzoic acid, 97%, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 0,5g, 2g, 250mg, 100g.
3-bromo-4-nitrobenzoic acid (CAS 101420-81-9) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 3-bromo-4-nitrobenzoic acid. InChIKey: KKPPNEJUUOQRLE-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 3-bromo-4-nitrobenzoic acid |
| InChIKey | KKPPNEJUUOQRLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)