Products 316808-10-3
CAS 316808-10-3 appears in our catalog under these names: 3-Bromopyridine-2,6-dicarboxylic acid, 95%, 2,6-Pyridinedicarboxylic acid, 3-bromo-, 90%, 90%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 5g, 1g, 50mg.
3-bromopyridine-2,6-dicarboxylic acid (CAS 316808-10-3) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 3-bromopyridine-2,6-dicarboxylic acid. InChIKey: IKHJUSWVJKICAT-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 3-bromopyridine-2,6-dicarboxylic acid |
| InChIKey | IKHJUSWVJKICAT-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Br)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)