Products 116529-61-4
CAS 116529-61-4 appears in our catalog under these names: 3-Bromo-2-nitrobenzoic acid, 98%, 3–Bromo–2–nitrobenzoic acid, 3-Bromo-2-nitrobenzoic acid, 3-Bromo-2-nitrobenzoic acid 95%, 3-Bromo-2-nitrobenzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg, 500mg.
3-bromo-2-nitrobenzoic acid (CAS 116529-61-4) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 3-bromo-2-nitrobenzoic acid. InChIKey: JAURIZJCCFDGDI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 3-bromo-2-nitrobenzoic acid |
| InChIKey | JAURIZJCCFDGDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)