CAS 7748-58-5 appears in our catalog under these names: 4-Bromo-5-nitro-1,2-methylenedioxybenzene, 96%, 5-Bromo-6-nitro-1,3-benzodioxole, 99.53%, 5-Bromo-6-nitrobenzo[d][1,3]dioxole, 98%, 98%, 5-Bromo-6-nitrobenzo[d][1,3]dioxole, 95%, 5-Bromo-6-nitrobenzo[d][1,3]dioxole, 98%. Offered by: Combi-blocks, MedChemExpress, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 5 g, 100 mg, 250 mg, 500 mg, 1 g, 100mg.
5-bromo-6-nitro-1,3-benzodioxole (CAS 7748-58-5) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 5-bromo-6-nitro-1,3-benzodioxole. InChIKey: WXXFALFBNSJISM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 5-bromo-6-nitro-1,3-benzodioxole |
| InChIKey | WXXFALFBNSJISM-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)