CAS 573-54-6 appears in our catalog under these names: 2–Bromo–3–nitrobenzoic acid, 2-Bromo-3-nitrobenzoic acid, 2-Bromo-3-nitrobenzoic Acid, >98.0%(T), 2-Bromo-3-nitrobenzoic acid, 98%, 98%, 2-Bromo-3-nitrobenzoic acid, 99.66%. Offered by: GLPBio, Biosynth, TCI, Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 50g, 5g, 250g, 500g, 250mg, 1g.
2-bromo-3-nitrobenzoic acid (CAS 573-54-6) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 2-bromo-3-nitrobenzoic acid. InChIKey: WTDJEGSXLFHZPY-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 2-bromo-3-nitrobenzoic acid |
| InChIKey | WTDJEGSXLFHZPY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Br)C(=O)O |
Computed by PubChem (NCBI)