Products 98555-51-2
CAS 98555-51-2 appears in our catalog under these names: 5-Bromo-pyridine-2,3-dicarboxylic acid, 5-Bromopyridine-2,3-dicarboxylic acid 97%, 5-Bromopyridine-2，3-dicarboxylic acid, 97%, 97%, 5-Bromopyridine-2,3-dicarboxylic acid, 97%. Offered by: Triz Pharma-Tech, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 500g, 100mg, 250mg, 1g, 5g, 10g, 25g.
5-bromopyridine-2,3-dicarboxylic acid (CAS 98555-51-2) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 5-bromopyridine-2,3-dicarboxylic acid. InChIKey: WDDREAGLVSBXOG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 5-bromopyridine-2,3-dicarboxylic acid |
| InChIKey | WDDREAGLVSBXOG-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)C(=O)O)Br |
Computed by PubChem (NCBI)