2-Bromo-6-methoxybenzenesulfonyl chloride, 96%
cas: 1261674-69-4 — see every product listed under this CAS number, including other names
2-Bromo-6-methoxybenzenesulfonyl chloride, 96% (CAS 1261674-69-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 50mg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11OOYE-100mg |
| cas | 1261674-69-4 |
| size | 100mg |
| availability | 15g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 770.00 Pln | |
| Chemat | 250mg | 1245.20 Pln | |
| Chemat | 1g | 2541.20 Pln | |
| Chemat | 5g | 4528.40 Pln | |
| Fluorochem | 100mg | 997.58 Pln | |
| Fluorochem | 250mg | 1632.78 Pln | |
| Fluorochem | 1g | 3319.68 Pln | |
| Fluorochem | 5g | 5922.93 Pln | |
| Fluorochem | 10g | 9176.99 Pln | |
| Fluorochem | 50mg | 622.72 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-bromo-6-methoxybenzenesulfonyl chloride (CAS 1261674-69-4) is a chemical compound with the molecular formula C7H6BrClO3S and a molecular weight of 285.54 g/mol. IUPAC name: 2-bromo-6-methoxybenzenesulfonyl chloride. InChIKey: SVJDLWOYMXELNX-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO3S |
|---|---|
| Molecular weight | 285.54 g/mol |
| IUPAC name | 2-bromo-6-methoxybenzenesulfonyl chloride |
| InChIKey | SVJDLWOYMXELNX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)