cas: 206993-29-5 — see every product listed under this CAS number, including other names
2-Bromo-N-(3,4-difluorophenyl)acetamide 95% (CAS 206993-29-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A766652-100mg |
| cas | 206993-29-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 492.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A766652 |
2-bromo-N-(3,4-difluorophenyl)acetamide (CAS 206993-29-5) is a chemical compound with the molecular formula C8H6BrF2NO and a molecular weight of 250.04 g/mol. IUPAC name: 2-bromo-N-(3,4-difluorophenyl)acetamide. InChIKey: NSXQVWQSUBGVKV-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO |
|---|---|
| Molecular weight | 250.04 g/mol |
| IUPAC name | 2-bromo-N-(3,4-difluorophenyl)acetamide |
| InChIKey | NSXQVWQSUBGVKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)CBr)F)F |
Computed by PubChem (NCBI)