Products 1375473-36-1
CAS 1375473-36-1 is the registry number for 2-(4-Bromophenyl)-2,2-difluoroacetamide 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-(4-bromophenyl)-2,2-difluoroacetamide (CAS 1375473-36-1) is a chemical compound with the molecular formula C8H6BrF2NO and a molecular weight of 250.04 g/mol. IUPAC name: 2-(4-bromophenyl)-2,2-difluoroacetamide. InChIKey: PAUISRPUWRJAIM-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO |
|---|---|
| Molecular weight | 250.04 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2,2-difluoroacetamide |
| InChIKey | PAUISRPUWRJAIM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)N)(F)F)Br |
Computed by PubChem (NCBI)