cas: 1261836-04-7 — see every product listed under this CAS number, including other names
2-CHLORO-5-TRIFLUOROMETHOXYBENZOIC ACID, 95% (CAS 1261836-04-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F334176-1G |
| cas | 1261836-04-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 5g | 1674.43 Pln | |
| Fluorochem | 10g | 2814.65 Pln | |
| Fluorochem | 25g | 5782.36 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-5-(trifluoromethoxy)benzoic acid (CAS 1261836-04-7) is a chemical compound with the molecular formula C8H4ClF3O3 and a molecular weight of 240.56 g/mol. IUPAC name: 2-chloro-5-(trifluoromethoxy)benzoic acid. InChIKey: ISTISDWJBPDHOU-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O3 |
|---|---|
| Molecular weight | 240.56 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethoxy)benzoic acid |
| InChIKey | ISTISDWJBPDHOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)C(=O)O)Cl |
Computed by PubChem (NCBI)