CAS 1261836-04-7 appears in our catalog under these names: 2-Chloro-5-(trifluoromethoxy)benzoic acid, 95%, 2-Chloro-5-(trifluoromethoxy)benzoic acid, 98%, 2-chloro-5-trifluoromethoxybenzoic acid, 2-Chloro-5-(trifluoromethoxy)benzoic acid, 95%, 95%, 2-CHLORO-5-TRIFLUOROMETHOXYBENZOIC ACID, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 2,5g, 100mg, 500mg, 10g.
2-chloro-5-(trifluoromethoxy)benzoic acid (CAS 1261836-04-7) is a chemical compound with the molecular formula C8H4ClF3O3 and a molecular weight of 240.56 g/mol. IUPAC name: 2-chloro-5-(trifluoromethoxy)benzoic acid. InChIKey: ISTISDWJBPDHOU-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O3 |
|---|---|
| Molecular weight | 240.56 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethoxy)benzoic acid |
| InChIKey | ISTISDWJBPDHOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)C(=O)O)Cl |
Computed by PubChem (NCBI)