CAS 1449205-27-9 is the registry number for 4-(Trifluoromethoxy)phenyl carbonochloridate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-(trifluoromethoxy)phenyl] carbonochloridate (CAS 1449205-27-9) is a chemical compound with the molecular formula C8H4ClF3O3 and a molecular weight of 240.56 g/mol. IUPAC name: [4-(trifluoromethoxy)phenyl] carbonochloridate. InChIKey: OMDGTIMRKQTDJX-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O3 |
|---|---|
| Molecular weight | 240.56 g/mol |
| IUPAC name | [4-(trifluoromethoxy)phenyl] carbonochloridate |
| InChIKey | OMDGTIMRKQTDJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC(=O)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)